Potassium erythorbate

Potassium erythorbate
Names

IUPAC name Potassium 5-(1,2-dihydroxyethyl)-3-hydroxy -4-oxo-furan-2-olate
Other names Erythorbic acid, potassium salt; E317
Identifiers
CAS Number	17175-66-5^Y
3D model (JSmol)	Interactive image
ChemSpider	30647045
EC Number	239-432-1
PubChem CID	102218423
InChI InChI=1S/C6H8O6.K/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,7-10H,1H2;/q;+1/p-1/t2-,5-;/m1./s1 Key: CONVKSGEGAVTMB-RKJRWTFHSA-M
SMILES [K+].[O-]C=1[C@H](OC(=O)C=1O)[C@H](O)CO
Properties
Chemical formula	C₆H₇KO₆
Molar mass	214.22 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Y verify (what is ^YN ?) Infobox references

Chemical compound

Potassium erythorbate (C₆H₇KO₆)^[1] is a food additive. Chemically, it is the potassium salt of erythorbic acid. As an antioxidant structurally related to vitamin C, it helps improve flavor stability and prevents the formation of carcinogenic nitrosamines.